C15H26N6O — CID 145147120
1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-phenylurea (PubChem CID 145147120) has the molecular formula C15H26N6O and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-phenylurea.
| Compound Name | 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 145147120 |
| Molecular Formula | C15H26N6O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-phenylurea |
| SMILES | CC1CC(NCCCN)NC(NC(=O)Nc2ccccc2)N1 |
| InChI | InChI=1S/C15H26N6O/c1-11-10-13(17-9-5-8-16)20-14(18-11)21-15(22)19-12-6-3-2-4-7-12/h2-4,6-7,11,13-14,17-18,20H,5,8-10,16H2,1H3,(H2,19,21,22) |
| InChIKey | JZNXLEOGGTYBRF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|