C21H32N6O — CID 134297686
1-[4-methyl-6-[4-(methylamino)butylamino]-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea (PubChem CID 134297686) has the molecular formula C21H32N6O and a molecular weight of 384.53 g/mol. Its IUPAC name is 1-[4-methyl-6-[4-(methylamino)butylamino]-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea.
| Compound Name | 1-[4-methyl-6-[4-(methylamino)butylamino]-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 134297686 |
| Molecular Formula | C21H32N6O |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 1-[4-methyl-6-[4-(methylamino)butylamino]-1,3-diazinan-2-yl]-3-naphthalen-2-ylurea |
| SMILES | CNCCCCNC1CC(C)NC(NC(=O)Nc2ccc3ccccc3c2)N1 |
| InChI | InChI=1S/C21H32N6O/c1-15-13-19(23-12-6-5-11-22-2)26-20(24-15)27-21(28)25-18-10-9-16-7-3-4-8-17(16)14-18/h3-4,7-10,14-15,19-20,22-24,26H,5-6,11-13H2,1-2H3,(H2,25,27,28) |
| InChIKey | JEBDJDWHYAAZFZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|