C17H33N5O — CID 140900445
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-(ethylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900445) has the molecular formula C17H33N5O and a molecular weight of 323.49 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-(ethylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-(ethylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900445 |
| Molecular Formula | C17H33N5O |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.27 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-3-[4-(ethylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CCNC1CC(C)NC(NC(=O)NC2CCC3CCCC3C2)N1 |
| InChI | InChI=1S/C17H33N5O/c1-3-18-15-9-11(2)19-16(21-15)22-17(23)20-14-8-7-12-5-4-6-13(12)10-14/h11-16,18-19,21H,3-10H2,1-2H3,(H2,20,22,23) |
| InChIKey | XIKLGEXEBKRLFO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |