C19H39N7O — CID 142295412
1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 142295412) has the molecular formula C19H39N7O and a molecular weight of 381.57 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 142295412 |
| Molecular Formula | C19H39N7O |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.32 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCN(C)C)NC(NC(=O)NC2CCC3CCCCC3N2)N1 |
| InChI | InChI=1S/C19H39N7O/c1-13-12-17(20-10-11-26(2)3)23-18(21-13)25-19(27)24-16-9-8-14-6-4-5-7-15(14)22-16/h13-18,20-23H,4-12H2,1-3H3,(H2,24,25,27) |
| InChIKey | LRSIYCWHEGFCSY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |