C16H31F3N6O2 — CID 140900462
1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-[3-(trifluoromethoxy)cyclohexyl]urea (PubChem CID 140900462) has the molecular formula C16H31F3N6O2 and a molecular weight of 396.46 g/mol. Its IUPAC name is 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-[3-(trifluoromethoxy)cyclohexyl]urea.
| Compound Name | 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-[3-(trifluoromethoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 140900462 |
| Molecular Formula | C16H31F3N6O2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 1-[4-(3-aminopropylamino)-6-methyl-1,3-diazinan-2-yl]-3-[3-(trifluoromethoxy)cyclohexyl]urea |
| SMILES | CC1CC(NCCCN)NC(NC(=O)NC2CCCC(OC(F)(F)F)C2)N1 |
| InChI | InChI=1S/C16H31F3N6O2/c1-10-8-13(21-7-3-6-20)24-14(22-10)25-15(26)23-11-4-2-5-12(9-11)27-16(17,18)19/h10-14,21-22,24H,2-9,20H2,1H3,(H2,23,25,26) |
| InChIKey | LJRDNCQATNUKKZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|