C14H18ClF3N4O2 — CID 134297449
1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[3-methyl-4-(trifluoromethoxy)phenyl]urea (PubChem CID 134297449) has the molecular formula C14H18ClF3N4O2 and a molecular weight of 366.77 g/mol. Its IUPAC name is 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[3-methyl-4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[3-methyl-4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 134297449 |
| Molecular Formula | C14H18ClF3N4O2 |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-[3-methyl-4-(trifluoromethoxy)phenyl]urea |
| SMILES | Cc1cc(NC(=O)NC2NC(C)CC(Cl)N2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C14H18ClF3N4O2/c1-7-5-9(3-4-10(7)24-14(16,17)18)20-13(23)22-12-19-8(2)6-11(15)21-12/h3-5,8,11-12,19,21H,6H2,1-2H3,(H2,20,22,23) |
| InChIKey | PANCVZHAHFEDNP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|