C13H19ClN4O — CID 145147051
1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-methylphenyl)urea (PubChem CID 145147051) has the molecular formula C13H19ClN4O and a molecular weight of 282.78 g/mol. Its IUPAC name is 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-methylphenyl)urea.
| Compound Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 145147051 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-(4-chloro-6-methyl-1,3-diazinan-2-yl)-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NC2NC(C)CC(Cl)N2)c1 |
| InChI | InChI=1S/C13H19ClN4O/c1-8-4-3-5-10(6-8)16-13(19)18-12-15-9(2)7-11(14)17-12/h3-6,9,11-12,15,17H,7H2,1-2H3,(H2,16,18,19) |
| InChIKey | MGDHVFVDUCNTBY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|