C20H33F3N6O2 — CID 166969835
1-[6-[3-(dimethylamino)propylamino]-1-propyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 166969835) has the molecular formula C20H33F3N6O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 1-[6-[3-(dimethylamino)propylamino]-1-propyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[6-[3-(dimethylamino)propylamino]-1-propyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 166969835 |
| Molecular Formula | C20H33F3N6O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 1-[6-[3-(dimethylamino)propylamino]-1-propyl-1,3-diazinan-2-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CCCN1C(NCCCN(C)C)CCNC1NC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H33F3N6O2/c1-4-13-29-17(24-11-5-14-28(2)3)10-12-25-18(29)27-19(30)26-15-6-8-16(9-7-15)31-20(21,22)23/h6-9,17-18,24-25H,4-5,10-14H2,1-3H3,(H2,26,27,30) |
| InChIKey | JSXSUXUJANTYCO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|