C14H21N3O2 — CID 108528764
N-(5-methyl-2-pyridinyl)-N',N'-dipropyloxamide (PubChem CID 108528764) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-N',N'-dipropyloxamide.
| Compound Name | N-(5-methyl-2-pyridinyl)-N',N'-dipropyloxamide |
|---|---|
| PubChem CID | 108528764 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-N',N'-dipropyloxamide |
| SMILES | CCCN(CCC)C(=O)C(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C14H21N3O2/c1-4-8-17(9-5-2)14(19)13(18)16-12-7-6-11(3)10-15-12/h6-7,10H,4-5,8-9H2,1-3H3,(H,15,16,18) |
| InChIKey | AXACHDQQPARNJF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|