C12H17N3O3 — CID 108525220
N'-ethyl-N'-(2-hydroxyethyl)-N-(5-methyl-2-pyridinyl)oxamide (PubChem CID 108525220) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is N'-ethyl-N'-(2-hydroxyethyl)-N-(5-methyl-2-pyridinyl)oxamide.
| Compound Name | N'-ethyl-N'-(2-hydroxyethyl)-N-(5-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108525220 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N'-ethyl-N'-(2-hydroxyethyl)-N-(5-methyl-2-pyridinyl)oxamide |
| SMILES | CCN(CCO)C(=O)C(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C12H17N3O3/c1-3-15(6-7-16)12(18)11(17)14-10-5-4-9(2)8-13-10/h4-5,8,16H,3,6-7H2,1-2H3,(H,13,14,17) |
| InChIKey | MEGCKGGKEXEXID-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|