C15H22N2O2 — CID 47334597
N'-butyl-N-(2,5-dimethylphenyl)-N'-methyloxamide (PubChem CID 47334597) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N'-butyl-N-(2,5-dimethylphenyl)-N'-methyloxamide.
| Compound Name | N'-butyl-N-(2,5-dimethylphenyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 47334597 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N'-butyl-N-(2,5-dimethylphenyl)-N'-methyloxamide |
| SMILES | CCCCN(C)C(=O)C(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C15H22N2O2/c1-5-6-9-17(4)15(19)14(18)16-13-10-11(2)7-8-12(13)3/h7-8,10H,5-6,9H2,1-4H3,(H,16,18) |
| InChIKey | UPVKXBIEHHBCJP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|