C15H18N4O3 — CID 91662057
N-(2,5-dimethylphenyl)-N'-methyl-N'-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]oxamide (PubChem CID 91662057) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N'-methyl-N'-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]oxamide.
| Compound Name | N-(2,5-dimethylphenyl)-N'-methyl-N'-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]oxamide |
|---|---|
| PubChem CID | 91662057 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N'-methyl-N'-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]oxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)N(C)Cc2noc(C)n2)c1 |
| InChI | InChI=1S/C15H18N4O3/c1-9-5-6-10(2)12(7-9)17-14(20)15(21)19(4)8-13-16-11(3)22-18-13/h5-7H,8H2,1-4H3,(H,17,20) |
| InChIKey | FXAJWUBFAYZPTL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|