C10H9N3OS2 — CID 35523950
2-phenylsulfanyl-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 35523950) has the molecular formula C10H9N3OS2 and a molecular weight of 251.34 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-phenylsulfanyl-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 35523950 |
| Molecular Formula | C10H9N3OS2 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 2-phenylsulfanyl-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(CSc1ccccc1)Nc1nncs1 |
| InChI | InChI=1S/C10H9N3OS2/c14-9(12-10-13-11-7-16-10)6-15-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,12,13,14) |
| InChIKey | IEGYSNNMCZYBJR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |