C10H8FN3OS — CID 29369711
2-(2-fluorophenyl)-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 29369711) has the molecular formula C10H8FN3OS and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 29369711 |
| Molecular Formula | C10H8FN3OS |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-(2-fluorophenyl)-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(Cc1ccccc1F)Nc1nncs1 |
| InChI | InChI=1S/C10H8FN3OS/c11-8-4-2-1-3-7(8)5-9(15)13-10-14-12-6-16-10/h1-4,6H,5H2,(H,13,14,15) |
| InChIKey | GIXXFROQBASFKK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |