C13H11N2O3S2- — CID 6932823
2-[2-[(2-phenylsulfanylacetyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 6932823) has the molecular formula C13H11N2O3S2- and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-[2-[(2-phenylsulfanylacetyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[(2-phenylsulfanylacetyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 6932823 |
| Molecular Formula | C13H11N2O3S2- |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 2-[2-[(2-phenylsulfanylacetyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | O=C([O-])Cc1csc(NC(=O)CSc2ccccc2)n1 |
| InChI | InChI=1S/C13H12N2O3S2/c16-11(8-19-10-4-2-1-3-5-10)15-13-14-9(7-20-13)6-12(17)18/h1-5,7H,6,8H2,(H,17,18)(H,14,15,16)/p-1 |
| InChIKey | BVHZUXOZVRGVON-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |