C22H19N5O2S3 — CID 54578644
N-[4-[[(Z)-[(5-methylthiadiazol-4-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]-2-phenylsulfanylacetamide (PubChem CID 54578644) has the molecular formula C22H19N5O2S3 and a molecular weight of 481.63 g/mol. Its IUPAC name is N-[4-[[(Z)-[(5-methylthiadiazol-4-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]-2-phenylsulfanylacetamide.
| Compound Name | N-[4-[[(Z)-[(5-methylthiadiazol-4-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 54578644 |
| Molecular Formula | C22H19N5O2S3 |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | N-[4-[[(Z)-[(5-methylthiadiazol-4-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]-2-phenylsulfanylacetamide |
| SMILES | Cc1snnc1/C(=N\OCc1csc(NC(=O)CSc2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C22H19N5O2S3/c1-15-20(25-27-32-15)21(16-8-4-2-5-9-16)26-29-12-17-13-31-22(23-17)24-19(28)14-30-18-10-6-3-7-11-18/h2-11,13H,12,14H2,1H3,(H,23,24,28)/b26-21- |
| InChIKey | ABVIJPGAMXRYLL-QLYXXIJNSA-N |
| XLogP | 5.00 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|