C19H23N3O2S — CID 59870815
N-[4-[[(Z)-1-phenylethylideneamino]oxymethyl]-1,3-thiazol-2-yl]cyclohexanecarboxamide (PubChem CID 59870815) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[4-[[(Z)-1-phenylethylideneamino]oxymethyl]-1,3-thiazol-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[4-[[(Z)-1-phenylethylideneamino]oxymethyl]-1,3-thiazol-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 59870815 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[4-[[(Z)-1-phenylethylideneamino]oxymethyl]-1,3-thiazol-2-yl]cyclohexanecarboxamide |
| SMILES | C/C(=N/OCc1csc(NC(=O)C2CCCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O2S/c1-14(15-8-4-2-5-9-15)22-24-12-17-13-25-19(20-17)21-18(23)16-10-6-3-7-11-16/h2,4-5,8-9,13,16H,3,6-7,10-12H2,1H3,(H,20,21,23)/b22-14- |
| InChIKey | RCZZLQFUKIBYDT-HMAPJEAMSA-N |
| XLogP | 4.60 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|