C22H23N7O2S — CID 66547557
3,3-dicyclopropyl-N-[4-[[(E)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 66547557) has the molecular formula C22H23N7O2S and a molecular weight of 449.54 g/mol. Its IUPAC name is 3,3-dicyclopropyl-N-[4-[[(E)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3,3-dicyclopropyl-N-[4-[[(E)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 66547557 |
| Molecular Formula | C22H23N7O2S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3,3-dicyclopropyl-N-[4-[[(E)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | Cn1nnnc1/C(=N/OCc1csc(NC(=O)C=C(C2CC2)C2CC2)n1)c1ccccc1 |
| InChI | InChI=1S/C22H23N7O2S/c1-29-21(25-27-28-29)20(16-5-3-2-4-6-16)26-31-12-17-13-32-22(23-17)24-19(30)11-18(14-7-8-14)15-9-10-15/h2-6,11,13-15H,7-10,12H2,1H3,(H,23,24,30)/b26-20+ |
| InChIKey | OGHIIWYCJPRJIP-LHLOQNFPSA-N |
| XLogP | 3.32 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|