C19H22FN7O3S — CID 86647360
tert-butyl N-[4-[[[(4-fluoro-3-methylphenyl)-(1-methyltetrazol-5-yl)methylidene]amino]oxymethyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 86647360) has the molecular formula C19H22FN7O3S and a molecular weight of 447.50 g/mol. Its IUPAC name is tert-butyl N-[4-[[[(4-fluoro-3-methylphenyl)-(1-methyltetrazol-5-yl)methylidene]amino]oxymethyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[[(4-fluoro-3-methylphenyl)-(1-methyltetrazol-5-yl)methylidene]amino]oxymethyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 86647360 |
| Molecular Formula | C19H22FN7O3S |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | tert-butyl N-[4-[[[(4-fluoro-3-methylphenyl)-(1-methyltetrazol-5-yl)methylidene]amino]oxymethyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | Cc1cc(C(=NOCc2csc(NC(=O)OC(C)(C)C)n2)c2nnnn2C)ccc1F |
| InChI | InChI=1S/C19H22FN7O3S/c1-11-8-12(6-7-14(11)20)15(16-23-25-26-27(16)5)24-29-9-13-10-31-17(21-13)22-18(28)30-19(2,3)4/h6-8,10H,9H2,1-5H3,(H,21,22,28) |
| InChIKey | YXJRZXXDLDQYGZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|