C16H14F3N7O — CID 150931639
1-(1-methyltetrazol-5-yl)-1-[4-methyl-3-(trifluoromethyl)phenyl]-N-(pyrimidin-2-ylmethoxy)methanimine (PubChem CID 150931639) has the molecular formula C16H14F3N7O and a molecular weight of 377.33 g/mol. Its IUPAC name is 1-(1-methyltetrazol-5-yl)-1-[4-methyl-3-(trifluoromethyl)phenyl]-N-(pyrimidin-2-ylmethoxy)methanimine.
| Compound Name | 1-(1-methyltetrazol-5-yl)-1-[4-methyl-3-(trifluoromethyl)phenyl]-N-(pyrimidin-2-ylmethoxy)methanimine |
|---|---|
| PubChem CID | 150931639 |
| Molecular Formula | C16H14F3N7O |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-(1-methyltetrazol-5-yl)-1-[4-methyl-3-(trifluoromethyl)phenyl]-N-(pyrimidin-2-ylmethoxy)methanimine |
| SMILES | Cc1ccc(C(=NOCc2ncccn2)c2nnnn2C)cc1C(F)(F)F |
| InChI | InChI=1S/C16H14F3N7O/c1-10-4-5-11(8-12(10)16(17,18)19)14(15-22-24-25-26(15)2)23-27-9-13-20-6-3-7-21-13/h3-8H,9H2,1-2H3 |
| InChIKey | LGDSOJIVLWFWEI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|