C14H12F3N7O2S — CID 87259588
4-[[(Z)-[(1-methyltetrazol-5-yl)-[3-(trifluoromethoxy)phenyl]methylidene]amino]oxymethyl]-1,3-thiazol-2-amine (PubChem CID 87259588) has the molecular formula C14H12F3N7O2S and a molecular weight of 399.36 g/mol. Its IUPAC name is 4-[[(Z)-[(1-methyltetrazol-5-yl)-[3-(trifluoromethoxy)phenyl]methylidene]amino]oxymethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[[(Z)-[(1-methyltetrazol-5-yl)-[3-(trifluoromethoxy)phenyl]methylidene]amino]oxymethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87259588 |
| Molecular Formula | C14H12F3N7O2S |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-[[(Z)-[(1-methyltetrazol-5-yl)-[3-(trifluoromethoxy)phenyl]methylidene]amino]oxymethyl]-1,3-thiazol-2-amine |
| SMILES | Cn1nnnc1/C(=N\OCc1csc(N)n1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3N7O2S/c1-24-12(20-22-23-24)11(21-25-6-9-7-27-13(18)19-9)8-3-2-4-10(5-8)26-14(15,16)17/h2-5,7H,6H2,1H3,(H2,18,19)/b21-11- |
| InChIKey | KPWZBJFPRXIHFK-NHDPSOOVSA-N |
| XLogP | 2.12 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|