C21H25N7O3S — CID 53247701
2-cyclohexyloxy-N-[4-[[(E)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 53247701) has the molecular formula C21H25N7O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-cyclohexyloxy-N-[4-[[(E)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-cyclohexyloxy-N-[4-[[(E)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 53247701 |
| Molecular Formula | C21H25N7O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-cyclohexyloxy-N-[4-[[(E)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | Cn1nnnc1/C(=N/OCc1csc(NC(=O)COC2CCCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C21H25N7O3S/c1-28-20(24-26-27-28)19(15-8-4-2-5-9-15)25-31-12-16-14-32-21(22-16)23-18(29)13-30-17-10-6-3-7-11-17/h2,4-5,8-9,14,17H,3,6-7,10-13H2,1H3,(H,22,23,29)/b25-19+ |
| InChIKey | XEQJRFQGTZYMRV-NCELDCMTSA-N |
| XLogP | 2.92 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|