C23H17N7O3 — CID 87259404
2-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]isoindole-1,3-dione (PubChem CID 87259404) has the molecular formula C23H17N7O3 and a molecular weight of 439.44 g/mol. Its IUPAC name is 2-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 87259404 |
| Molecular Formula | C23H17N7O3 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]isoindole-1,3-dione |
| SMILES | Cn1nnnc1/C(=N\OCc1cccc(N2C(=O)c3ccccc3C2=O)n1)c1ccccc1 |
| InChI | InChI=1S/C23H17N7O3/c1-29-21(25-27-28-29)20(15-8-3-2-4-9-15)26-33-14-16-10-7-13-19(24-16)30-22(31)17-11-5-6-12-18(17)23(30)32/h2-13H,14H2,1H3/b26-20- |
| InChIKey | FWCOJLYFYPNNMO-QOMWVZHYSA-N |
| XLogP | 2.37 |
| TPSA | 115.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|