C21H25N7O3 — CID 151416096
1-[6-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]pentyl carbamate (PubChem CID 151416096) has the molecular formula C21H25N7O3 and a molecular weight of 423.48 g/mol. Its IUPAC name is 1-[6-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]pentyl carbamate.
| Compound Name | 1-[6-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]pentyl carbamate |
|---|---|
| PubChem CID | 151416096 |
| Molecular Formula | C21H25N7O3 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[6-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]pentyl carbamate |
| SMILES | CCCCC(OC(N)=O)c1cccc(CON=C(c2ccccc2)c2nnnn2C)n1 |
| InChI | InChI=1S/C21H25N7O3/c1-3-4-13-18(31-21(22)29)17-12-8-11-16(23-17)14-30-25-19(15-9-6-5-7-10-15)20-24-26-27-28(20)2/h5-12,18H,3-4,13-14H2,1-2H3,(H2,22,29) |
| InChIKey | OZOAYKVNGSNNPK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|