C26H35N7O3 — CID 89272931
2,3-dimethyl-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]-4-propan-2-yloxyhexanamide (PubChem CID 89272931) has the molecular formula C26H35N7O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is 2,3-dimethyl-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]-4-propan-2-yloxyhexanamide.
| Compound Name | 2,3-dimethyl-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]-4-propan-2-yloxyhexanamide |
|---|---|
| PubChem CID | 89272931 |
| Molecular Formula | C26H35N7O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 2,3-dimethyl-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]-4-propan-2-yloxyhexanamide |
| SMILES | CCC(OC(C)C)C(C)C(C)C(=O)Nc1cccc(CO/N=C(/c2ccccc2)c2nnnn2C)n1 |
| InChI | InChI=1S/C26H35N7O3/c1-7-22(36-17(2)3)18(4)19(5)26(34)28-23-15-11-14-21(27-23)16-35-30-24(20-12-9-8-10-13-20)25-29-31-32-33(25)6/h8-15,17-19,22H,7,16H2,1-6H3,(H,27,28,34)/b30-24- |
| InChIKey | PGXPEALJLMROEM-KRUMMXJUSA-N |
| XLogP | 3.99 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|