C21H25N7O3S — CID 89272788
2-ethoxy-2-ethylsulfanyl-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]acetamide (PubChem CID 89272788) has the molecular formula C21H25N7O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-ethoxy-2-ethylsulfanyl-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]acetamide.
| Compound Name | 2-ethoxy-2-ethylsulfanyl-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 89272788 |
| Molecular Formula | C21H25N7O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-ethoxy-2-ethylsulfanyl-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]acetamide |
| SMILES | CCOC(SCC)C(=O)Nc1cccc(CO/N=C(/c2ccccc2)c2nnnn2C)n1 |
| InChI | InChI=1S/C21H25N7O3S/c1-4-30-21(32-5-2)20(29)23-17-13-9-12-16(22-17)14-31-25-18(15-10-7-6-8-11-15)19-24-26-27-28(19)3/h6-13,21H,4-5,14H2,1-3H3,(H,22,23,29)/b25-18- |
| InChIKey | LOUZUYSAKRDZME-BWAHOGKJSA-N |
| XLogP | 2.63 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|