C21H24N8O3 — CID 58567422
(2E)-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]-2-propoxyiminopropanamide (PubChem CID 58567422) has the molecular formula C21H24N8O3 and a molecular weight of 436.48 g/mol. Its IUPAC name is (2E)-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]-2-propoxyiminopropanamide.
| Compound Name | (2E)-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]-2-propoxyiminopropanamide |
|---|---|
| PubChem CID | 58567422 |
| Molecular Formula | C21H24N8O3 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (2E)-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]-2-propoxyiminopropanamide |
| SMILES | CCCO/N=C(\C)C(=O)Nc1cccc(CO/N=C(/c2ccccc2)c2nnnn2C)n1 |
| InChI | InChI=1S/C21H24N8O3/c1-4-13-31-25-15(2)21(30)23-18-12-8-11-17(22-18)14-32-26-19(16-9-6-5-7-10-16)20-24-27-28-29(20)3/h5-12H,4,13-14H2,1-3H3,(H,22,23,30)/b25-15+,26-19- |
| InChIKey | LIKGDIHPIVBVQC-ZYMOVUKLSA-N |
| XLogP | 2.32 |
| TPSA | 128.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|