C22H25N7O4 — CID 123423572
(4-methyloxan-4-yl) N-[6-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate (PubChem CID 123423572) has the molecular formula C22H25N7O4 and a molecular weight of 451.49 g/mol. Its IUPAC name is (4-methyloxan-4-yl) N-[6-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate.
| Compound Name | (4-methyloxan-4-yl) N-[6-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 123423572 |
| Molecular Formula | C22H25N7O4 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (4-methyloxan-4-yl) N-[6-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
| SMILES | Cn1nnnc1C(=NOCc1cccc(NC(=O)OC2(C)CCOCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C22H25N7O4/c1-22(11-13-31-14-12-22)33-21(30)24-18-10-6-9-17(23-18)15-32-26-19(16-7-4-3-5-8-16)20-25-27-28-29(20)2/h3-10H,11-15H2,1-2H3,(H,23,24,30) |
| InChIKey | NEMOPUUTBQFSPQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|