C24H31N7O6 — CID 89272897
2,2-bis(2-methoxyethoxy)-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]propanamide (PubChem CID 89272897) has the molecular formula C24H31N7O6 and a molecular weight of 513.56 g/mol. Its IUPAC name is 2,2-bis(2-methoxyethoxy)-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]propanamide.
| Compound Name | 2,2-bis(2-methoxyethoxy)-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 89272897 |
| Molecular Formula | C24H31N7O6 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 2,2-bis(2-methoxyethoxy)-N-[6-[[(Z)-[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]propanamide |
| SMILES | COCCOC(C)(OCCOC)C(=O)Nc1cccc(CO/N=C(/c2ccccc2)c2nnnn2C)n1 |
| InChI | InChI=1S/C24H31N7O6/c1-24(35-15-13-33-3,36-16-14-34-4)23(32)26-20-12-8-11-19(25-20)17-37-28-21(18-9-6-5-7-10-18)22-27-29-30-31(22)2/h5-12H,13-17H2,1-4H3,(H,25,26,32)/b28-21- |
| InChIKey | RXRPVYDIYTVWSF-HFTWOUSFSA-N |
| XLogP | 1.55 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|