C20H23N7O2S — CID 53483290
2,2-dimethyl-N-[4-[[(E)-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]amino]oxymethyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 53483290) has the molecular formula C20H23N7O2S and a molecular weight of 425.52 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-[[(E)-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]amino]oxymethyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-[[(E)-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]amino]oxymethyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 53483290 |
| Molecular Formula | C20H23N7O2S |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2,2-dimethyl-N-[4-[[(E)-[phenyl-(1-prop-2-enyltetrazol-5-yl)methylidene]amino]oxymethyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | C=CCn1nnnc1/C(=N/OCc1csc(NC(=O)C(C)(C)C)n1)c1ccccc1 |
| InChI | InChI=1S/C20H23N7O2S/c1-5-11-27-17(23-25-26-27)16(14-9-7-6-8-10-14)24-29-12-15-13-30-19(21-15)22-18(28)20(2,3)4/h5-10,13H,1,11-12H2,2-4H3,(H,21,22,28)/b24-16+ |
| InChIKey | NXYOVHXVHPEPNA-LFVJCYFKSA-N |
| XLogP | 3.27 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|