C25H23N7O2S — CID 66547205
(E)-3-cyclopropyl-N-[4-[[(E)-[(5-methyltetrazol-1-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide (PubChem CID 66547205) has the molecular formula C25H23N7O2S and a molecular weight of 485.57 g/mol. Its IUPAC name is (E)-3-cyclopropyl-N-[4-[[(E)-[(5-methyltetrazol-1-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-3-cyclopropyl-N-[4-[[(E)-[(5-methyltetrazol-1-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 66547205 |
| Molecular Formula | C25H23N7O2S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (E)-3-cyclopropyl-N-[4-[[(E)-[(5-methyltetrazol-1-yl)-phenylmethylidene]amino]oxymethyl]-1,3-thiazol-2-yl]-3-phenylprop-2-enamide |
| SMILES | Cc1nnnn1/C(=N/OCc1csc(NC(=O)/C=C(/c2ccccc2)C2CC2)n1)c1ccccc1 |
| InChI | InChI=1S/C25H23N7O2S/c1-17-28-30-31-32(17)24(20-10-6-3-7-11-20)29-34-15-21-16-35-25(26-21)27-23(33)14-22(19-12-13-19)18-8-4-2-5-9-18/h2-11,14,16,19H,12-13,15H2,1H3,(H,26,27,33)/b22-14-,29-24+ |
| InChIKey | MLSXGFIIKKMINH-NISLRYSNSA-N |
| XLogP | 4.30 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|