C15H14N8O5S — CID 174995852
[2-(carboxyamino)-1,3-thiazol-4-yl]-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]carbamic acid (PubChem CID 174995852) has the molecular formula C15H14N8O5S and a molecular weight of 418.40 g/mol. Its IUPAC name is [2-(carboxyamino)-1,3-thiazol-4-yl]-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]carbamic acid.
| Compound Name | [2-(carboxyamino)-1,3-thiazol-4-yl]-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]carbamic acid |
|---|---|
| PubChem CID | 174995852 |
| Molecular Formula | C15H14N8O5S |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [2-(carboxyamino)-1,3-thiazol-4-yl]-[[[(1-methyltetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]carbamic acid |
| SMILES | Cn1nnnc1C(=NOCN(C(=O)O)c1csc(NC(=O)O)n1)c1ccccc1 |
| InChI | InChI=1S/C15H14N8O5S/c1-22-12(18-20-21-22)11(9-5-3-2-4-6-9)19-28-8-23(15(26)27)10-7-29-13(16-10)17-14(24)25/h2-7H,8H2,1H3,(H,16,17)(H,24,25)(H,26,27) |
| InChIKey | KACBNSUJXOZKEZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 167.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|