C13H13F5N4O3 — CID 170308357
2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(2,3,4,5,6-pentafluorophenyl)propanamide (PubChem CID 170308357) has the molecular formula C13H13F5N4O3 and a molecular weight of 368.26 g/mol. Its IUPAC name is 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(2,3,4,5,6-pentafluorophenyl)propanamide.
| Compound Name | 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(2,3,4,5,6-pentafluorophenyl)propanamide |
|---|---|
| PubChem CID | 170308357 |
| Molecular Formula | C13H13F5N4O3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(2,3,4,5,6-pentafluorophenyl)propanamide |
| SMILES | NCC(=O)NCC(=O)NC(Cc1c(F)c(F)c(F)c(F)c1F)C(N)=O |
| InChI | InChI=1S/C13H13F5N4O3/c14-8-4(9(15)11(17)12(18)10(8)16)1-5(13(20)25)22-7(24)3-21-6(23)2-19/h5H,1-3,19H2,(H2,20,25)(H,21,23)(H,22,24) |
| InChIKey | ZXKLKCVGYYPSMA-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|