C13H23N5O — CID 114387208
2-(aminomethyl)-N-(5,6-diethyl-1,2,4-triazin-3-yl)pentanamide (PubChem CID 114387208) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(5,6-diethyl-1,2,4-triazin-3-yl)pentanamide.
| Compound Name | 2-(aminomethyl)-N-(5,6-diethyl-1,2,4-triazin-3-yl)pentanamide |
|---|---|
| PubChem CID | 114387208 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 2-(aminomethyl)-N-(5,6-diethyl-1,2,4-triazin-3-yl)pentanamide |
| SMILES | CCCC(CN)C(=O)Nc1nnc(CC)c(CC)n1 |
| InChI | InChI=1S/C13H23N5O/c1-4-7-9(8-14)12(19)16-13-15-10(5-2)11(6-3)17-18-13/h9H,4-8,14H2,1-3H3,(H,15,16,18,19) |
| InChIKey | MTVMDOZGXCGTDI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |