C11H17BrN4O — CID 114387164
2-bromo-N-(5,6-diethyl-1,2,4-triazin-3-yl)butanamide (PubChem CID 114387164) has the molecular formula C11H17BrN4O and a molecular weight of 301.19 g/mol. Its IUPAC name is 2-bromo-N-(5,6-diethyl-1,2,4-triazin-3-yl)butanamide.
| Compound Name | 2-bromo-N-(5,6-diethyl-1,2,4-triazin-3-yl)butanamide |
|---|---|
| PubChem CID | 114387164 |
| Molecular Formula | C11H17BrN4O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-bromo-N-(5,6-diethyl-1,2,4-triazin-3-yl)butanamide |
| SMILES | CCc1nnc(NC(=O)C(Br)CC)nc1CC |
| InChI | InChI=1S/C11H17BrN4O/c1-4-7(12)10(17)14-11-13-8(5-2)9(6-3)15-16-11/h7H,4-6H2,1-3H3,(H,13,14,16,17) |
| InChIKey | SYVICPNBTOYMLC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|