C12H22N4 — CID 105362359
5,6-diethyl-N-pentan-3-yl-1,2,4-triazin-3-amine (PubChem CID 105362359) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 5,6-diethyl-N-pentan-3-yl-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-pentan-3-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362359 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 5,6-diethyl-N-pentan-3-yl-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NC(CC)CC)nc1CC |
| InChI | InChI=1S/C12H22N4/c1-5-9(6-2)13-12-14-10(7-3)11(8-4)15-16-12/h9H,5-8H2,1-4H3,(H,13,14,16) |
| InChIKey | NIKZQXJWORYPAX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |