C10H18N4 — CID 114383143
5,6-dimethyl-N-pentan-3-yl-1,2,4-triazin-3-amine (PubChem CID 114383143) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 5,6-dimethyl-N-pentan-3-yl-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-pentan-3-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114383143 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 5,6-dimethyl-N-pentan-3-yl-1,2,4-triazin-3-amine |
| SMILES | CCC(CC)Nc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C10H18N4/c1-5-9(6-2)12-10-11-7(3)8(4)13-14-10/h9H,5-6H2,1-4H3,(H,11,12,14) |
| InChIKey | ULZCWXOXOMWVDU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |