C11H17F3N4 — CID 105362761
5,6-diethyl-N-(4,4,4-trifluorobutyl)-1,2,4-triazin-3-amine (PubChem CID 105362761) has the molecular formula C11H17F3N4 and a molecular weight of 262.28 g/mol. Its IUPAC name is 5,6-diethyl-N-(4,4,4-trifluorobutyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-(4,4,4-trifluorobutyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362761 |
| Molecular Formula | C11H17F3N4 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5,6-diethyl-N-(4,4,4-trifluorobutyl)-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCCCC(F)(F)F)nc1CC |
| InChI | InChI=1S/C11H17F3N4/c1-3-8-9(4-2)17-18-10(16-8)15-7-5-6-11(12,13)14/h3-7H2,1-2H3,(H,15,16,18) |
| InChIKey | YMNLSABKGQNVHE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|