C12H22N4O — CID 105362667
5,6-diethyl-N-(1-methoxybutan-2-yl)-1,2,4-triazin-3-amine (PubChem CID 105362667) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 5,6-diethyl-N-(1-methoxybutan-2-yl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-(1-methoxybutan-2-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105362667 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 5,6-diethyl-N-(1-methoxybutan-2-yl)-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NC(CC)COC)nc1CC |
| InChI | InChI=1S/C12H22N4O/c1-5-9(8-17-4)13-12-14-10(6-2)11(7-3)15-16-12/h9H,5-8H2,1-4H3,(H,13,14,16) |
| InChIKey | KWPJNGHXZFTZHB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |