C15H29N5 — CID 105362544
2-N-(5,6-diethyl-1,2,4-triazin-3-yl)-1-N,1-N,4-trimethylpentane-1,2-diamine (PubChem CID 105362544) has the molecular formula C15H29N5 and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-N-(5,6-diethyl-1,2,4-triazin-3-yl)-1-N,1-N,4-trimethylpentane-1,2-diamine.
| Compound Name | 2-N-(5,6-diethyl-1,2,4-triazin-3-yl)-1-N,1-N,4-trimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 105362544 |
| Molecular Formula | C15H29N5 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | 2-N-(5,6-diethyl-1,2,4-triazin-3-yl)-1-N,1-N,4-trimethylpentane-1,2-diamine |
| SMILES | CCc1nnc(NC(CC(C)C)CN(C)C)nc1CC |
| InChI | InChI=1S/C15H29N5/c1-7-13-14(8-2)18-19-15(17-13)16-12(9-11(3)4)10-20(5)6/h11-12H,7-10H2,1-6H3,(H,16,17,19) |
| InChIKey | DLMSZXRSVJTQAU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |