C13H19N5O — CID 114387944
2-cyano-N-(5,6-diethyl-1,2,4-triazin-3-yl)-3-methylbutanamide (PubChem CID 114387944) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-cyano-N-(5,6-diethyl-1,2,4-triazin-3-yl)-3-methylbutanamide.
| Compound Name | 2-cyano-N-(5,6-diethyl-1,2,4-triazin-3-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 114387944 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-cyano-N-(5,6-diethyl-1,2,4-triazin-3-yl)-3-methylbutanamide |
| SMILES | CCc1nnc(NC(=O)C(C#N)C(C)C)nc1CC |
| InChI | InChI=1S/C13H19N5O/c1-5-10-11(6-2)17-18-13(15-10)16-12(19)9(7-14)8(3)4/h8-9H,5-6H2,1-4H3,(H,15,16,18,19) |
| InChIKey | XEPVTDKCOCWVAC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |