C12H17N5O — CID 114387662
N-(5,6-diethyl-1,2,4-triazin-3-yl)-2-(prop-2-ynylamino)acetamide (PubChem CID 114387662) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is N-(5,6-diethyl-1,2,4-triazin-3-yl)-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-(5,6-diethyl-1,2,4-triazin-3-yl)-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 114387662 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-(5,6-diethyl-1,2,4-triazin-3-yl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)Nc1nnc(CC)c(CC)n1 |
| InChI | InChI=1S/C12H17N5O/c1-4-7-13-8-11(18)15-12-14-9(5-2)10(6-3)16-17-12/h1,13H,5-8H2,2-3H3,(H,14,15,17,18) |
| InChIKey | AVNHQFNUMFAPNK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|