C13H17IN2OS — CID 114257454
2-carbamothioyl-N-(5-iodo-2-methylphenyl)-3-methylbutanamide (PubChem CID 114257454) has the molecular formula C13H17IN2OS and a molecular weight of 376.26 g/mol. Its IUPAC name is 2-carbamothioyl-N-(5-iodo-2-methylphenyl)-3-methylbutanamide.
| Compound Name | 2-carbamothioyl-N-(5-iodo-2-methylphenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 114257454 |
| Molecular Formula | C13H17IN2OS |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 2-carbamothioyl-N-(5-iodo-2-methylphenyl)-3-methylbutanamide |
| SMILES | Cc1ccc(I)cc1NC(=O)C(C(N)=S)C(C)C |
| InChI | InChI=1S/C13H17IN2OS/c1-7(2)11(12(15)18)13(17)16-10-6-9(14)5-4-8(10)3/h4-7,11H,1-3H3,(H2,15,18)(H,16,17) |
| InChIKey | SUHAVQFWJORYNH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|