C11H21N3O2S — CID 106345624
N-(1-amino-3-methyl-1-oxobutan-2-yl)-2-carbamothioyl-3-methylbutanamide (PubChem CID 106345624) has the molecular formula C11H21N3O2S and a molecular weight of 259.38 g/mol. Its IUPAC name is N-(1-amino-3-methyl-1-oxobutan-2-yl)-2-carbamothioyl-3-methylbutanamide.
| Compound Name | N-(1-amino-3-methyl-1-oxobutan-2-yl)-2-carbamothioyl-3-methylbutanamide |
|---|---|
| PubChem CID | 106345624 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-(1-amino-3-methyl-1-oxobutan-2-yl)-2-carbamothioyl-3-methylbutanamide |
| SMILES | CC(C)C(NC(=O)C(C(N)=S)C(C)C)C(N)=O |
| InChI | InChI=1S/C11H21N3O2S/c1-5(2)7(10(13)17)11(16)14-8(6(3)4)9(12)15/h5-8H,1-4H3,(H2,12,15)(H2,13,17)(H,14,16) |
| InChIKey | WZPAUOLKFWVFFH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|