C6H14N4OS — CID 106346207
2-(aminocarbamothioylamino)-3-methylbutanamide (PubChem CID 106346207) has the molecular formula C6H14N4OS and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-(aminocarbamothioylamino)-3-methylbutanamide.
| Compound Name | 2-(aminocarbamothioylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 106346207 |
| Molecular Formula | C6H14N4OS |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-(aminocarbamothioylamino)-3-methylbutanamide |
| SMILES | CC(C)C(NC(=S)NN)C(N)=O |
| InChI | InChI=1S/C6H14N4OS/c1-3(2)4(5(7)11)9-6(12)10-8/h3-4H,8H2,1-2H3,(H2,7,11)(H2,9,10,12) |
| InChIKey | SLFVCKOAVSCLAQ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|