C9H19N3OS — CID 106344675
3-methyl-2-(propan-2-ylcarbamothioylamino)butanamide (PubChem CID 106344675) has the molecular formula C9H19N3OS and a molecular weight of 217.34 g/mol. Its IUPAC name is 3-methyl-2-(propan-2-ylcarbamothioylamino)butanamide.
| Compound Name | 3-methyl-2-(propan-2-ylcarbamothioylamino)butanamide |
|---|---|
| PubChem CID | 106344675 |
| Molecular Formula | C9H19N3OS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-methyl-2-(propan-2-ylcarbamothioylamino)butanamide |
| SMILES | CC(C)NC(=S)NC(C(N)=O)C(C)C |
| InChI | InChI=1S/C9H19N3OS/c1-5(2)7(8(10)13)12-9(14)11-6(3)4/h5-7H,1-4H3,(H2,10,13)(H2,11,12,14) |
| InChIKey | BLYSTCDMNMWDCB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|