C10H21N3OS — CID 106344679
2-(butylcarbamothioylamino)-3-methylbutanamide (PubChem CID 106344679) has the molecular formula C10H21N3OS and a molecular weight of 231.36 g/mol. Its IUPAC name is 2-(butylcarbamothioylamino)-3-methylbutanamide.
| Compound Name | 2-(butylcarbamothioylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 106344679 |
| Molecular Formula | C10H21N3OS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(butylcarbamothioylamino)-3-methylbutanamide |
| SMILES | CCCCNC(=S)NC(C(N)=O)C(C)C |
| InChI | InChI=1S/C10H21N3OS/c1-4-5-6-12-10(15)13-8(7(2)3)9(11)14/h7-8H,4-6H2,1-3H3,(H2,11,14)(H2,12,13,15) |
| InChIKey | RMZPKZJYSWQVCF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|