C9H20N2O2S — CID 173402637
acetic acid;1,3-di(propan-2-yl)thiourea (PubChem CID 173402637) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is acetic acid;1,3-di(propan-2-yl)thiourea.
| Compound Name | acetic acid;1,3-di(propan-2-yl)thiourea |
|---|---|
| PubChem CID | 173402637 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | acetic acid;1,3-di(propan-2-yl)thiourea |
| SMILES | CC(=O)O.CC(C)NC(=S)NC(C)C |
| InChI | InChI=1S/C7H16N2S.C2H4O2/c1-5(2)8-7(10)9-6(3)4;1-2(3)4/h5-6H,1-4H3,(H2,8,9,10);1H3,(H,3,4) |
| InChIKey | CHFICUXRBCHDSL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|