C10H18N4OS2 — CID 10265379
N-(cyanomethyl)-3-methylsulfanyl-2-(propan-2-ylcarbamothioylamino)propanamide (PubChem CID 10265379) has the molecular formula C10H18N4OS2 and a molecular weight of 274.42 g/mol. Its IUPAC name is N-(cyanomethyl)-3-methylsulfanyl-2-(propan-2-ylcarbamothioylamino)propanamide.
| Compound Name | N-(cyanomethyl)-3-methylsulfanyl-2-(propan-2-ylcarbamothioylamino)propanamide |
|---|---|
| PubChem CID | 10265379 |
| Molecular Formula | C10H18N4OS2 |
| Molecular Weight | 274.42 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-(cyanomethyl)-3-methylsulfanyl-2-(propan-2-ylcarbamothioylamino)propanamide |
| SMILES | CSCC(NC(=S)NC(C)C)C(=O)NCC#N |
| InChI | InChI=1S/C10H18N4OS2/c1-7(2)13-10(16)14-8(6-17-3)9(15)12-5-4-11/h7-8H,5-6H2,1-3H3,(H,12,15)(H2,13,14,16) |
| InChIKey | YRVQWPICFLWCNL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|