C11H20N4OS2 — CID 87926982
N-(2-cyanoethyl)-3-methylsulfanyl-2-(propan-2-ylcarbamothioylamino)propanamide (PubChem CID 87926982) has the molecular formula C11H20N4OS2 and a molecular weight of 288.44 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-methylsulfanyl-2-(propan-2-ylcarbamothioylamino)propanamide.
| Compound Name | N-(2-cyanoethyl)-3-methylsulfanyl-2-(propan-2-ylcarbamothioylamino)propanamide |
|---|---|
| PubChem CID | 87926982 |
| Molecular Formula | C11H20N4OS2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-(2-cyanoethyl)-3-methylsulfanyl-2-(propan-2-ylcarbamothioylamino)propanamide |
| SMILES | CSCC(NC(=S)NC(C)C)C(=O)NCCC#N |
| InChI | InChI=1S/C11H20N4OS2/c1-8(2)14-11(17)15-9(7-18-3)10(16)13-6-4-5-12/h8-9H,4,6-7H2,1-3H3,(H,13,16)(H2,14,15,17) |
| InChIKey | LSZXMOGPFRAXNK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|